C25H31NO4 — CID 5106847
[[3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] cyclohexanecarboxylate (PubChem CID 5106847) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is [[3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] cyclohexanecarboxylate.
| Compound Name | [[3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 5106847 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | [[3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] cyclohexanecarboxylate |
| SMILES | CC12CCC(C(=Cc3ccc4c(c3)OCO4)C1=NOC(=O)C1CCCCC1)C2(C)C |
| InChI | InChI=1S/C25H31NO4/c1-24(2)19-11-12-25(24,3)22(26-30-23(27)17-7-5-4-6-8-17)18(19)13-16-9-10-20-21(14-16)29-15-28-20/h9-10,13-14,17,19H,4-8,11-12,15H2,1-3H3 |
| InChIKey | CSHRWEZQTOFHHH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|