C23H20O5 — CID 6523576
(2E,6E)-2,6-bis(1,3-benzodioxol-5-ylmethylidene)-3-methylcyclohexan-1-one (PubChem CID 6523576) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is (2E,6E)-2,6-bis(1,3-benzodioxol-5-ylmethylidene)-3-methylcyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis(1,3-benzodioxol-5-ylmethylidene)-3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 6523576 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (2E,6E)-2,6-bis(1,3-benzodioxol-5-ylmethylidene)-3-methylcyclohexan-1-one |
| SMILES | CC1CC/C(=C\c2ccc3c(c2)OCO3)C(=O)/C1=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H20O5/c1-14-2-5-17(8-15-3-6-19-21(10-15)27-12-25-19)23(24)18(14)9-16-4-7-20-22(11-16)28-13-26-20/h3-4,6-11,14H,2,5,12-13H2,1H3/b17-8+,18-9+ |
| InChIKey | VKCHMLVEDVFTTP-YPOGWSRFSA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|