C25H30N2O5S2 — CID 125114085
4-[(E)-[(3E,4S)-3-[[4-(dimethylsulfamoyl)phenyl]methylidene]-4-methyl-2-oxocyclohexylidene]methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 125114085) has the molecular formula C25H30N2O5S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 4-[(E)-[(3E,4S)-3-[[4-(dimethylsulfamoyl)phenyl]methylidene]-4-methyl-2-oxocyclohexylidene]methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[(E)-[(3E,4S)-3-[[4-(dimethylsulfamoyl)phenyl]methylidene]-4-methyl-2-oxocyclohexylidene]methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 125114085 |
| Molecular Formula | C25H30N2O5S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 4-[(E)-[(3E,4S)-3-[[4-(dimethylsulfamoyl)phenyl]methylidene]-4-methyl-2-oxocyclohexylidene]methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | C[C@H]1CC/C(=C\c2ccc(S(=O)(=O)N(C)C)cc2)C(=O)/C1=C/c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O5S2/c1-18-6-11-21(16-19-7-12-22(13-8-19)33(29,30)26(2)3)25(28)24(18)17-20-9-14-23(15-10-20)34(31,32)27(4)5/h7-10,12-18H,6,11H2,1-5H3/b21-16+,24-17+/t18-/m0/s1 |
| InChIKey | GXCPZXJAMCZBHS-SUYBAANKSA-N |
| XLogP | 3.65 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|