C19H25NO3S — CID 75144722
N,N-dimethyl-4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonamide (PubChem CID 75144722) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75144722 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N,N-dimethyl-4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C=C2C(=O)C3(C)CCC2C3(C)C)cc1 |
| InChI | InChI=1S/C19H25NO3S/c1-18(2)16-10-11-19(18,3)17(21)15(16)12-13-6-8-14(9-7-13)24(22,23)20(4)5/h6-9,12,16H,10-11H2,1-5H3 |
| InChIKey | MRLAORHSMCGARA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|