C18H20O5S — CID 172827640
oxo-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methanesulfonic acid (PubChem CID 172827640) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is oxo-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methanesulfonic acid.
| Compound Name | oxo-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 172827640 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | oxo-[4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methanesulfonic acid |
| SMILES | CC12CCC(C(=Cc3ccc(C(=O)S(=O)(=O)O)cc3)C1=O)C2(C)C |
| InChI | InChI=1S/C18H20O5S/c1-17(2)14-8-9-18(17,3)15(19)13(14)10-11-4-6-12(7-5-11)16(20)24(21,22)23/h4-7,10,14H,8-9H2,1-3H3,(H,21,22,23) |
| InChIKey | VBXSSZJYEHBQTK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|