C17H17Cl2NO2 — CID 10688365
[(E)-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino] 2,4-dichlorobenzoate (PubChem CID 10688365) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is [(E)-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino] 2,4-dichlorobenzoate.
| Compound Name | [(E)-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 10688365 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | [(E)-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]decanylidene]amino] 2,4-dichlorobenzoate |
| SMILES | O=C(O/N=C1\C[C@@H]2C[C@H]1[C@H]1CCC[C@@H]21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2NO2/c18-10-4-5-13(15(19)8-10)17(21)22-20-16-7-9-6-14(16)12-3-1-2-11(9)12/h4-5,8-9,11-12,14H,1-3,6-7H2/b20-16+/t9-,11-,12-,14-/m0/s1 |
| InChIKey | SZHWSULCAVRNGN-PDCCMWAJSA-N |
| XLogP | 4.96 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|