C12H6Cl2F3N3O3 — CID 6050133
[(E)-[1-methyl-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]amino] 2,4-dichlorobenzoate (PubChem CID 6050133) has the molecular formula C12H6Cl2F3N3O3 and a molecular weight of 368.10 g/mol. Its IUPAC name is [(E)-[1-methyl-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]amino] 2,4-dichlorobenzoate.
| Compound Name | [(E)-[1-methyl-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 6050133 |
| Molecular Formula | C12H6Cl2F3N3O3 |
| Molecular Weight | 368.10 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | [(E)-[1-methyl-5-oxo-3-(trifluoromethyl)pyrazol-4-ylidene]amino] 2,4-dichlorobenzoate |
| SMILES | CN1N=C(C(F)(F)F)/C(=N\OC(=O)c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C12H6Cl2F3N3O3/c1-20-10(21)8(9(18-20)12(15,16)17)19-23-11(22)6-3-2-5(13)4-7(6)14/h2-4H,1H3/b19-8+ |
| InChIKey | KGBKVVNHUVFUHA-UFWORHAWSA-N |
| XLogP | 2.90 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.10 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|