C15H17Cl2NO2 — CID 13293303
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-dichlorobenzoate (PubChem CID 13293303) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-dichlorobenzoate.
| Compound Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 13293303 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-dichlorobenzoate |
| SMILES | CN1[C@@H]2CC[C@H]1CC(OC(=O)c1ccc(Cl)cc1Cl)C2 |
| InChI | InChI=1S/C15H17Cl2NO2/c1-18-10-3-4-11(18)8-12(7-10)20-15(19)13-5-2-9(16)6-14(13)17/h2,5-6,10-12H,3-4,7-8H2,1H3/t10-,11+,12? |
| InChIKey | DOEWFFMHBXNGPS-FOSCPWQOSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |