C22H24ClNO2 — CID 3057560
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-chlorophenyl)-2-phenylacetate (PubChem CID 3057560) has the molecular formula C22H24ClNO2 and a molecular weight of 369.89 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-chlorophenyl)-2-phenylacetate.
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-chlorophenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 3057560 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-chlorophenyl)-2-phenylacetate |
| SMILES | CN1C2CCC1CC(OC(=O)C(c1ccccc1)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C22H24ClNO2/c1-24-18-11-12-19(24)14-20(13-18)26-22(25)21(15-5-3-2-4-6-15)16-7-9-17(23)10-8-16/h2-10,18-21H,11-14H2,1H3 |
| InChIKey | KWQCDVBTWNVKET-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |