About [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate (PubChem CID 10473293) has the molecular formula C18H24ClNO2S
and a molecular weight of 353.92 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate.
Molecular Properties
| Compound Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate |
| PubChem CID | 10473293 |
| Molecular Formula | C18H24ClNO2S |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)OC1C[C@H]2CC[C@@H](C1)N2C |
| InChI | InChI=1S/C18H24ClNO2S/c1-3-17(23-16-8-4-12(19)5-9-16)18(21)22-15-10-13-6-7-14(11-15)20(13)2/h4-5,8-9,13-15,17H,3,6-7,10-11H2,1-2H3/t13-,14+,15?,17-/m1/s1 |
| InChIKey | HRZJJXGXZVSRIB-KJFZJZGVSA-N |
| XLogP | 4.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate?
The IUPAC name of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate (CID 10473293) is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate.
What is the SMILES notation for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate?
The canonical SMILES for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate is CC[C@@H](Sc1ccc(Cl)cc1)C(=O)OC1C[C@H]2CC[C@@H](C1)N2C.
What is the InChIKey of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate?
The InChIKey is HRZJJXGXZVSRIB-KJFZJZGVSA-N. The full InChI is InChI=1S/C18H24ClNO2S/c1-3-17(23-16-8-4-12(19)5-9-16)18(21)22-15-10-13-6-7-14(11-15)20(13)2/h4-5,8-9,13-15,17H,3,6-7,10-11H2,1-2H3/t13-,14+,15?,17-/m1/s1.
What are the key properties of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate?
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate has a molecular weight of 353.92 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-2-(4-chlorophenyl)sulfanylbutanoate is sourced from PubChem (CID 10473293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).