C17H21Cl2NO2 — CID 131882601
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(3-chlorophenyl)prop-2-enoate;hydrochloride (PubChem CID 131882601) has the molecular formula C17H21Cl2NO2 and a molecular weight of 342.27 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(3-chlorophenyl)prop-2-enoate;hydrochloride.
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(3-chlorophenyl)prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 131882601 |
| Molecular Formula | C17H21Cl2NO2 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(3-chlorophenyl)prop-2-enoate;hydrochloride |
| SMILES | C=C(C(=O)OC1CC2CCC(C1)N2C)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C17H20ClNO2.ClH/c1-11(12-4-3-5-13(18)8-12)17(20)21-16-9-14-6-7-15(10-16)19(14)2;/h3-5,8,14-16H,1,6-7,9-10H2,2H3;1H |
| InChIKey | NNYJOYIOFGFCFP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|