C18H15Cl2NO3 — CID 136847482
[(Z)-[(3R)-6-hydroxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene]amino] 2,4-dichlorobenzoate (PubChem CID 136847482) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is [(Z)-[(3R)-6-hydroxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene]amino] 2,4-dichlorobenzoate.
| Compound Name | [(Z)-[(3R)-6-hydroxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene]amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 136847482 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [(Z)-[(3R)-6-hydroxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene]amino] 2,4-dichlorobenzoate |
| SMILES | C[C@H]1C/C(=N/OC(=O)c2ccc(Cl)cc2Cl)c2ccc(O)cc2C1 |
| InChI | InChI=1S/C18H15Cl2NO3/c1-10-6-11-8-13(22)3-5-14(11)17(7-10)21-24-18(23)15-4-2-12(19)9-16(15)20/h2-5,8-10,22H,6-7H2,1H3/b21-17-/t10-/m1/s1 |
| InChIKey | MQWVSCRXDSPNAP-LGTIGEJYSA-N |
| XLogP | 4.84 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|