C28H26N4O7 — CID 4714581
[[1,7,7-trimethyl-4-(naphthalen-1-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate (PubChem CID 4714581) has the molecular formula C28H26N4O7 and a molecular weight of 530.54 g/mol. Its IUPAC name is [[1,7,7-trimethyl-4-(naphthalen-1-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate.
| Compound Name | [[1,7,7-trimethyl-4-(naphthalen-1-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 4714581 |
| Molecular Formula | C28H26N4O7 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [[1,7,7-trimethyl-4-(naphthalen-1-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate |
| SMILES | CC12CCC(C(=O)Nc3cccc4ccccc34)(CC1=NOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C2(C)C |
| InChI | InChI=1S/C28H26N4O7/c1-26(2)27(3)11-12-28(26,25(34)29-22-10-6-8-17-7-4-5-9-21(17)22)16-23(27)30-39-24(33)18-13-19(31(35)36)15-20(14-18)32(37)38/h4-10,13-15H,11-12,16H2,1-3H3,(H,29,34) |
| InChIKey | BJUBKLQJTVDAFF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|