C24H22Cl3N3O5 — CID 6198280
[(Z)-[4-[(3,4-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate (PubChem CID 6198280) has the molecular formula C24H22Cl3N3O5 and a molecular weight of 538.82 g/mol. Its IUPAC name is [(Z)-[4-[(3,4-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate.
| Compound Name | [(Z)-[4-[(3,4-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 6198280 |
| Molecular Formula | C24H22Cl3N3O5 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | [(Z)-[4-[(3,4-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate |
| SMILES | CC12CCC(C(=O)Nc3ccc(Cl)c(Cl)c3)(C/C1=N/OC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C2(C)C |
| InChI | InChI=1S/C24H22Cl3N3O5/c1-22(2)23(3)8-9-24(22,21(32)28-14-5-7-15(25)17(27)11-14)12-19(23)29-35-20(31)13-4-6-16(26)18(10-13)30(33)34/h4-7,10-11H,8-9,12H2,1-3H3,(H,28,32)/b29-19- |
| InChIKey | OYSAZIKETDWLMS-CEUNXORHSA-N |
| XLogP | 6.92 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|