C24H28N2O5 — CID 4714539
[[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate (PubChem CID 4714539) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is [[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate.
| Compound Name | [[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 4714539 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate |
| SMILES | CC(C)NC(=O)C12CCC(C)(C(=NOC(=O)c3cc4ccccc4oc3=O)C1)C2(C)C |
| InChI | InChI=1S/C24H28N2O5/c1-14(2)25-21(29)24-11-10-23(5,22(24,3)4)18(13-24)26-31-20(28)16-12-15-8-6-7-9-17(15)30-19(16)27/h6-9,12,14H,10-11,13H2,1-5H3,(H,25,29) |
| InChIKey | MFKVRPZIGFOFNZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|