C22H24O6 — CID 6959589
[(1R,2R,4S)-4-methoxycarbonyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxochromene-3-carboxylate (PubChem CID 6959589) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is [(1R,2R,4S)-4-methoxycarbonyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxochromene-3-carboxylate.
| Compound Name | [(1R,2R,4S)-4-methoxycarbonyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 6959589 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(1R,2R,4S)-4-methoxycarbonyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxochromene-3-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@@](C)([C@H](OC(=O)c3cc4ccccc4oc3=O)C1)C2(C)C |
| InChI | InChI=1S/C22H24O6/c1-20(2)21(3)9-10-22(20,19(25)26-4)12-16(21)28-18(24)14-11-13-7-5-6-8-15(13)27-17(14)23/h5-8,11,16H,9-10,12H2,1-4H3/t16-,21+,22-/m1/s1 |
| InChIKey | HRLPOZCJNLVAKW-URZJWIJPSA-N |
| XLogP | 3.71 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|