C21H27N3O5 — CID 4714533
[[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 4-nitrobenzoate (PubChem CID 4714533) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is [[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 4-nitrobenzoate.
| Compound Name | [[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 4714533 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [[1,7,7-trimethyl-4-(propan-2-ylcarbamoyl)-2-bicyclo[2.2.1]heptanylidene]amino] 4-nitrobenzoate |
| SMILES | CC(C)NC(=O)C12CCC(C)(C(=NOC(=O)c3ccc([N+](=O)[O-])cc3)C1)C2(C)C |
| InChI | InChI=1S/C21H27N3O5/c1-13(2)22-18(26)21-11-10-20(5,19(21,3)4)16(12-21)23-29-17(25)14-6-8-15(9-7-14)24(27)28/h6-9,13H,10-12H2,1-5H3,(H,22,26) |
| InChIKey | CGSSJWKWWSJLRE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|