C18H24N2O2 — CID 50930153
(1R,3Z,4R)-3-hydroxyimino-4,7,7-trimethyl-N-(3-methylphenyl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 50930153) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1R,3Z,4R)-3-hydroxyimino-4,7,7-trimethyl-N-(3-methylphenyl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,3Z,4R)-3-hydroxyimino-4,7,7-trimethyl-N-(3-methylphenyl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 50930153 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (1R,3Z,4R)-3-hydroxyimino-4,7,7-trimethyl-N-(3-methylphenyl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@]23CC[C@@](C)(/C(=N\O)C2)C3(C)C)c1 |
| InChI | InChI=1S/C18H24N2O2/c1-12-6-5-7-13(10-12)19-15(21)18-9-8-17(4,16(18,2)3)14(11-18)20-22/h5-7,10,22H,8-9,11H2,1-4H3,(H,19,21)/b20-14-/t17-,18-/m0/s1 |
| InChIKey | VWCWMIWZTVRELG-FNSOMLPHSA-N |
| XLogP | 3.98 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|