C33H44O3Si — CID 177461140
[(1S,3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-1,2,3,4,5,6-hexahydropentalen-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 177461140) has the molecular formula C33H44O3Si and a molecular weight of 516.80 g/mol. Its IUPAC name is [(1S,3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-1,2,3,4,5,6-hexahydropentalen-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-1,2,3,4,5,6-hexahydropentalen-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177461140 |
| Molecular Formula | C33H44O3Si |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [(1S,3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-1,2,3,4,5,6-hexahydropentalen-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C[C@H]1CCC2=C1[C@@H](COC(=O)C(C)(C)C)C[C@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H44O3Si/c1-8-24-19-20-29-25(21-26(30(24)29)22-35-31(34)32(2,3)4)23-36-37(33(5,6)7,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h8-18,24-26H,1,19-23H2,2-7H3/t24-,25-,26+/m0/s1 |
| InChIKey | YWCHCQSSFKBBCP-KKUQBAQOSA-N |
| XLogP | 6.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|