C28H36N2O3Si — CID 171063383
ethyl 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-1,4,5,7-tetrahydroindazole-3-carboxylate (PubChem CID 171063383) has the molecular formula C28H36N2O3Si and a molecular weight of 476.69 g/mol. Its IUPAC name is ethyl 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-1,4,5,7-tetrahydroindazole-3-carboxylate.
| Compound Name | ethyl 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-1,4,5,7-tetrahydroindazole-3-carboxylate |
|---|---|
| PubChem CID | 171063383 |
| Molecular Formula | C28H36N2O3Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | ethyl 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-1,4,5,7-tetrahydroindazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2c1CCC(C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C2 |
| InChI | InChI=1S/C28H36N2O3Si/c1-6-32-26(31)25-23-17-18-28(5,19-24(23)29-30-25)20-33-34(27(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16H,6,17-20H2,1-5H3,(H,29,30) |
| InChIKey | JYVOHZAWEGOHQP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|