C36H36O2Si — CID 173074395
(3-benzhydryl-2-methoxyphenoxy)-tert-butyl-diphenylsilane (PubChem CID 173074395) has the molecular formula C36H36O2Si and a molecular weight of 528.77 g/mol. Its IUPAC name is (3-benzhydryl-2-methoxyphenoxy)-tert-butyl-diphenylsilane.
| Compound Name | (3-benzhydryl-2-methoxyphenoxy)-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 173074395 |
| Molecular Formula | C36H36O2Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | (3-benzhydryl-2-methoxyphenoxy)-tert-butyl-diphenylsilane |
| SMILES | COc1c(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cccc1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H36O2Si/c1-36(2,3)39(30-22-13-7-14-23-30,31-24-15-8-16-25-31)38-33-27-17-26-32(35(33)37-4)34(28-18-9-5-10-19-28)29-20-11-6-12-21-29/h5-27,34H,1-4H3 |
| InChIKey | JIONLXCHLZYOPQ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|