C34H40O5Si — CID 58025120
(1R)-1-[5-[tert-butyl(diphenyl)silyl]oxy-2,3-dimethoxy-4-methylphenyl]-2-phenylmethoxyethanol (PubChem CID 58025120) has the molecular formula C34H40O5Si and a molecular weight of 556.78 g/mol. Its IUPAC name is (1R)-1-[5-[tert-butyl(diphenyl)silyl]oxy-2,3-dimethoxy-4-methylphenyl]-2-phenylmethoxyethanol.
| Compound Name | (1R)-1-[5-[tert-butyl(diphenyl)silyl]oxy-2,3-dimethoxy-4-methylphenyl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 58025120 |
| Molecular Formula | C34H40O5Si |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | (1R)-1-[5-[tert-butyl(diphenyl)silyl]oxy-2,3-dimethoxy-4-methylphenyl]-2-phenylmethoxyethanol |
| SMILES | COc1c([C@@H](O)COCc2ccccc2)cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(C)c1OC |
| InChI | InChI=1S/C34H40O5Si/c1-25-31(39-40(34(2,3)4,27-18-12-8-13-19-27)28-20-14-9-15-21-28)22-29(33(37-6)32(25)36-5)30(35)24-38-23-26-16-10-7-11-17-26/h7-22,30,35H,23-24H2,1-6H3/t30-/m0/s1 |
| InChIKey | VLBPCGMZDUVDIJ-PMERELPUSA-N |
| XLogP | 6.20 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|