C33H35N3O4Si — CID 11664131
[7-[(1R)-1-azido-2-phenylmethoxyethyl]-4-methyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 11664131) has the molecular formula C33H35N3O4Si and a molecular weight of 565.75 g/mol. Its IUPAC name is [7-[(1R)-1-azido-2-phenylmethoxyethyl]-4-methyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [7-[(1R)-1-azido-2-phenylmethoxyethyl]-4-methyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11664131 |
| Molecular Formula | C33H35N3O4Si |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | [7-[(1R)-1-azido-2-phenylmethoxyethyl]-4-methyl-1,3-benzodioxol-5-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | Cc1c(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc([C@H](COCc2ccccc2)N=[N+]=[N-])c2c1OCO2 |
| InChI | InChI=1S/C33H35N3O4Si/c1-24-30(40-41(33(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27)20-28(32-31(24)38-23-39-32)29(35-36-34)22-37-21-25-14-8-5-9-15-25/h5-20,29H,21-23H2,1-4H3/t29-/m0/s1 |
| InChIKey | OPESKMWOGPIZDN-LJAQVGFWSA-N |
| XLogP | 7.23 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|