C29H33N3O2Si — CID 10552846
[(1S,4S)-4-azido-2-(phenylmethoxymethyl)cyclopent-2-en-1-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 10552846) has the molecular formula C29H33N3O2Si and a molecular weight of 483.69 g/mol. Its IUPAC name is [(1S,4S)-4-azido-2-(phenylmethoxymethyl)cyclopent-2-en-1-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(1S,4S)-4-azido-2-(phenylmethoxymethyl)cyclopent-2-en-1-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10552846 |
| Molecular Formula | C29H33N3O2Si |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [(1S,4S)-4-azido-2-(phenylmethoxymethyl)cyclopent-2-en-1-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@H]1C[C@H](N=[N+]=[N-])C=C1COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33N3O2Si/c1-29(2,3)35(26-15-9-5-10-16-26,27-17-11-6-12-18-27)34-28-20-25(31-32-30)19-24(28)22-33-21-23-13-7-4-8-14-23/h4-19,25,28H,20-22H2,1-3H3/t25-,28+/m1/s1 |
| InChIKey | OOPPARFLNGWVGZ-NAKRPHOHSA-N |
| XLogP | 6.16 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|