C28H41N3O2Si2 — CID 70963461
[(3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 70963461) has the molecular formula C28H41N3O2Si2 and a molecular weight of 507.83 g/mol. Its IUPAC name is [(3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 70963461 |
| Molecular Formula | C28H41N3O2Si2 |
| Molecular Weight | 507.83 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | [(3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C28H41N3O2Si2/c1-27(2,3)34(7,8)33-26-20-22(19-25(26)30-31-29)21-32-35(28(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-19,25-26H,20-21H2,1-8H3/t25-,26?/m0/s1 |
| InChIKey | FZXJHGVNZABLPW-PMCHYTPCSA-N |
| XLogP | 6.96 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.83 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|