C24H33NO6 — CID 11316395
2,2-diethoxy-N-[(1R)-1-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)-2-phenylmethoxyethyl]ethanamine (PubChem CID 11316395) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2,2-diethoxy-N-[(1R)-1-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)-2-phenylmethoxyethyl]ethanamine.
| Compound Name | 2,2-diethoxy-N-[(1R)-1-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)-2-phenylmethoxyethyl]ethanamine |
|---|---|
| PubChem CID | 11316395 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 2,2-diethoxy-N-[(1R)-1-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)-2-phenylmethoxyethyl]ethanamine |
| SMILES | CCOC(CN[C@@H](COCc1ccccc1)c1cc(OC)c(C)c2c1OCO2)OCC |
| InChI | InChI=1S/C24H33NO6/c1-5-28-22(29-6-2)13-25-20(15-27-14-18-10-8-7-9-11-18)19-12-21(26-4)17(3)23-24(19)31-16-30-23/h7-12,20,22,25H,5-6,13-16H2,1-4H3/t20-/m0/s1 |
| InChIKey | GIIKLOCKGWNRCD-FQEVSTJZSA-N |
| XLogP | 3.98 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|