C19H28O4 — CID 126715628
5-(2,2-diethoxyethoxy)hex-2-ynoxymethylbenzene (PubChem CID 126715628) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 5-(2,2-diethoxyethoxy)hex-2-ynoxymethylbenzene.
| Compound Name | 5-(2,2-diethoxyethoxy)hex-2-ynoxymethylbenzene |
|---|---|
| PubChem CID | 126715628 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 5-(2,2-diethoxyethoxy)hex-2-ynoxymethylbenzene |
| SMILES | CCOC(COC(C)CC#CCOCc1ccccc1)OCC |
| InChI | InChI=1S/C19H28O4/c1-4-21-19(22-5-2)16-23-17(3)11-9-10-14-20-15-18-12-7-6-8-13-18/h6-8,12-13,17,19H,4-5,11,14-16H2,1-3H3 |
| InChIKey | YDMSPPDMZYBQSY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|