C18H32O5 — CID 174717970
ethoxymethylbenzene;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol (PubChem CID 174717970) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is ethoxymethylbenzene;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol.
| Compound Name | ethoxymethylbenzene;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 174717970 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | ethoxymethylbenzene;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
| SMILES | CC(O)COC(C)COC(C)CO.CCOCc1ccccc1 |
| InChI | InChI=1S/C9H20O4.C9H12O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-2-10-8-9-6-4-3-5-7-9/h7-11H,4-6H2,1-3H3;3-7H,2,8H2,1H3 |
| InChIKey | ZYBKFLGIXNNLFP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |