C17H38O7 — CID 87173315
ethoxyethane;ethyl acetate;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol (PubChem CID 87173315) has the molecular formula C17H38O7 and a molecular weight of 354.48 g/mol. Its IUPAC name is ethoxyethane;ethyl acetate;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol.
| Compound Name | ethoxyethane;ethyl acetate;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 87173315 |
| Molecular Formula | C17H38O7 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | ethoxyethane;ethyl acetate;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
| SMILES | CC(O)COC(C)COC(C)CO.CCOC(C)=O.CCOCC |
| InChI | InChI=1S/C9H20O4.C4H8O2.C4H10O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-3-6-4(2)5;1-3-5-4-2/h7-11H,4-6H2,1-3H3;3H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | FPZMQRSPJJEICJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |