C29H28O4SSi — CID 25263860
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrobenzo[h][1,4]benzoxathiine-5,6-dione (PubChem CID 25263860) has the molecular formula C29H28O4SSi and a molecular weight of 500.69 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrobenzo[h][1,4]benzoxathiine-5,6-dione.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrobenzo[h][1,4]benzoxathiine-5,6-dione |
|---|---|
| PubChem CID | 25263860 |
| Molecular Formula | C29H28O4SSi |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrobenzo[h][1,4]benzoxathiine-5,6-dione |
| SMILES | CC(C)(C)[Si](OCC1CSC2=C(O1)c1ccccc1C(=O)C2=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28O4SSi/c1-29(2,3)35(21-12-6-4-7-13-21,22-14-8-5-9-15-22)32-18-20-19-34-28-26(31)25(30)23-16-10-11-17-24(23)27(28)33-20/h4-17,20H,18-19H2,1-3H3 |
| InChIKey | JFMIGTUCAFFHKJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|