C33H39NO9Si — CID 175949814
2-[(3aR,4R,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]acetic acid;4-nitrobenzoic acid (PubChem CID 175949814) has the molecular formula C33H39NO9Si and a molecular weight of 621.76 g/mol. Its IUPAC name is 2-[(3aR,4R,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]acetic acid;4-nitrobenzoic acid.
| Compound Name | 2-[(3aR,4R,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]acetic acid;4-nitrobenzoic acid |
|---|---|
| PubChem CID | 175949814 |
| Molecular Formula | C33H39NO9Si |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | 2-[(3aR,4R,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]acetic acid;4-nitrobenzoic acid |
| SMILES | COC1C[C@H]2[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC(CC(=O)O)[C@@H]2O1.O=C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H34O5Si.C7H5NO4/c1-26(2,3)32(19-11-7-5-8-12-19,20-13-9-6-10-14-20)31-22-15-18(16-23(27)28)25-21(22)17-24(29-4)30-25;9-7(10)5-1-3-6(4-2-5)8(11)12/h5-14,18,21-22,24-25H,15-17H2,1-4H3,(H,27,28);1-4H,(H,9,10)/t18?,21-,22+,24?,25-;/m0./s1 |
| InChIKey | LXANUZSRHXPJDF-MTHKICEGSA-N |
| XLogP | 5.10 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|