C29H36O5Si — CID 10480830
[(1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate (PubChem CID 10480830) has the molecular formula C29H36O5Si and a molecular weight of 492.69 g/mol. Its IUPAC name is [(1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate.
| Compound Name | [(1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate |
|---|---|
| PubChem CID | 10480830 |
| Molecular Formula | C29H36O5Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | [(1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]buta-2,3-dienyl] acetate |
| SMILES | C=C=C[C@H](OC(C)=O)[C@H]1O[C@H](OCC)C=C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36O5Si/c1-7-15-25(32-22(3)30)28-26(20-21-27(33-28)31-8-2)34-35(29(4,5)6,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-21,25-28H,1,8H2,2-6H3/t25-,26-,27-,28+/m0/s1 |
| InChIKey | UAKZEVNJPGDBKC-LAJGZZDBSA-N |
| XLogP | 4.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|