C42H53NO7Si2 — CID 171121822
[(1R)-1-[(2S,3R,4R,5R)-4-acetamido-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate (PubChem CID 171121822) has the molecular formula C42H53NO7Si2 and a molecular weight of 740.06 g/mol. Its IUPAC name is [(1R)-1-[(2S,3R,4R,5R)-4-acetamido-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate.
| Compound Name | [(1R)-1-[(2S,3R,4R,5R)-4-acetamido-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate |
|---|---|
| PubChem CID | 171121822 |
| Molecular Formula | C42H53NO7Si2 |
| Molecular Weight | 740.06 g/mol |
| Exact Mass | 739.34 |
| IUPAC Name | [(1R)-1-[(2S,3R,4R,5R)-4-acetamido-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyoxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)=O)O[C@H]1O |
| InChI | InChI=1S/C42H53NO7Si2/c1-30(44)43-37-39(50-52(42(6,7)8,34-25-17-11-18-26-34)35-27-19-12-20-28-35)38(49-40(37)46)36(48-31(2)45)29-47-51(41(3,4)5,32-21-13-9-14-22-32)33-23-15-10-16-24-33/h9-28,36-40,46H,29H2,1-8H3,(H,43,44)/t36-,37-,38+,39-,40-/m1/s1 |
| InChIKey | OEEJQVPSQMGZEL-JSMBFNCYSA-N |
| XLogP | 4.66 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.06 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|