C30H40O9Si — CID 102260345
ethyl (2S,4S,5R)-4-acetyloxy-5-[1-acetyloxy-2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methoxyoxolane-2-carboxylate (PubChem CID 102260345) has the molecular formula C30H40O9Si and a molecular weight of 572.73 g/mol. Its IUPAC name is ethyl (2S,4S,5R)-4-acetyloxy-5-[1-acetyloxy-2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methoxyoxolane-2-carboxylate.
| Compound Name | ethyl (2S,4S,5R)-4-acetyloxy-5-[1-acetyloxy-2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methoxyoxolane-2-carboxylate |
|---|---|
| PubChem CID | 102260345 |
| Molecular Formula | C30H40O9Si |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | ethyl (2S,4S,5R)-4-acetyloxy-5-[1-acetyloxy-2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methoxyoxolane-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(OC)C[C@H](OC(C)=O)[C@H](C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)=O)O1 |
| InChI | InChI=1S/C30H40O9Si/c1-8-35-28(33)30(34-7)19-25(37-21(2)31)27(39-30)26(38-22(3)32)20-36-40(29(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,25-27H,8,19-20H2,1-7H3/t25-,26?,27+,30-/m0/s1 |
| InChIKey | KDLDZGTUFPBCJA-GWAVTLKSSA-N |
| XLogP | 3.12 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|