C30H36O6Si — CID 101256997
[(2R,3S,6S)-3-acetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxybut-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101256997) has the molecular formula C30H36O6Si and a molecular weight of 520.70 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxybut-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxybut-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101256997 |
| Molecular Formula | C30H36O6Si |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[4-[tert-butyl(diphenyl)silyl]oxybut-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H36O6Si/c1-23(31)33-22-29-28(35-24(2)32)20-19-25(36-29)14-12-13-21-34-37(30(3,4)5,26-15-8-6-9-16-26)27-17-10-7-11-18-27/h6-11,15-20,25,28-29H,13,21-22H2,1-5H3/t25-,28+,29-/m1/s1 |
| InChIKey | TYTPZWKHNNMYFB-QUFBTCJSSA-N |
| XLogP | 3.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|