C18H41IO2Si2 — CID 45101159
tert-butyl-[(2S)-1-iodo-3-tri(propan-2-yl)silyloxypropan-2-yl]oxy-dimethylsilane (PubChem CID 45101159) has the molecular formula C18H41IO2Si2 and a molecular weight of 472.60 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-iodo-3-tri(propan-2-yl)silyloxypropan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-1-iodo-3-tri(propan-2-yl)silyloxypropan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 45101159 |
| Molecular Formula | C18H41IO2Si2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | tert-butyl-[(2S)-1-iodo-3-tri(propan-2-yl)silyloxypropan-2-yl]oxy-dimethylsilane |
| SMILES | CC(C)[Si](OC[C@@H](CI)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H41IO2Si2/c1-14(2)23(15(3)4,16(5)6)20-13-17(12-19)21-22(10,11)18(7,8)9/h14-17H,12-13H2,1-11H3/t17-/m1/s1 |
| InChIKey | YHSOFBKISBKHEF-QGZVFWFLSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|