C15H33NO2SSi — CID 175168614
tert-butyl-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]amino]-oxidosulfanium (PubChem CID 175168614) has the molecular formula C15H33NO2SSi and a molecular weight of 319.59 g/mol. Its IUPAC name is tert-butyl-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175168614 |
| Molecular Formula | C15H33NO2SSi |
| Molecular Weight | 319.59 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]amino]-oxidosulfanium |
| SMILES | C=CC[C@H](CO[Si](C)(C)C(C)(C)C)N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C15H33NO2SSi/c1-10-11-13(16-19(17)14(2,3)4)12-18-20(8,9)15(5,6)7/h10,13,16H,1,11-12H2,2-9H3/t13-,19?/m1/s1 |
| InChIKey | CZMVTIXHFRHUBH-BSOCMFCZSA-N |
| XLogP | 4.00 |
| TPSA | 44.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|