C19H35N5O2SSi — CID 175140331
[[(2R)-1-(6-azido-2-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 175140331) has the molecular formula C19H35N5O2SSi and a molecular weight of 425.68 g/mol. Its IUPAC name is [[(2R)-1-(6-azido-2-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(2R)-1-(6-azido-2-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175140331 |
| Molecular Formula | C19H35N5O2SSi |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | [[(2R)-1-(6-azido-2-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H](CCO[Si](C)(C)C(C)(C)C)Cc1cccc(N=[N+]=[N-])n1 |
| InChI | InChI=1S/C19H35N5O2SSi/c1-18(2,3)27(25)23-16(12-13-26-28(7,8)19(4,5)6)14-15-10-9-11-17(21-15)22-24-20/h9-11,16,23H,12-14H2,1-8H3/t16-,27?/m0/s1 |
| InChIKey | QANXYTXMQPCWQA-CJKOFORZSA-N |
| XLogP | 5.40 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|