C32H47N3O3Si2 — CID 136704425
2-[[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3-dipyridin-2-ylpropan-2-yl]iminomethyl]phenol (PubChem CID 136704425) has the molecular formula C32H47N3O3Si2 and a molecular weight of 577.92 g/mol. Its IUPAC name is 2-[[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3-dipyridin-2-ylpropan-2-yl]iminomethyl]phenol.
| Compound Name | 2-[[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3-dipyridin-2-ylpropan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136704425 |
| Molecular Formula | C32H47N3O3Si2 |
| Molecular Weight | 577.92 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 2-[[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3-dipyridin-2-ylpropan-2-yl]iminomethyl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](c1ccccn1)C(/N=C/c1ccccc1O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C32H47N3O3Si2/c1-31(2,3)39(7,8)37-29(25-18-13-15-21-33-25)28(35-23-24-17-11-12-20-27(24)36)30(26-19-14-16-22-34-26)38-40(9,10)32(4,5)6/h11-23,28-30,36H,1-10H3/b35-23+/t29-,30-/m1/s1 |
| InChIKey | KEWUTNYHYVZQIM-BLQSTINZSA-N |
| XLogP | 8.50 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.92 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|