C15H17NS2 — CID 23584919
2-[1,1-bis(methylsulfanyl)-2-phenylethyl]pyridine (PubChem CID 23584919) has the molecular formula C15H17NS2 and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-[1,1-bis(methylsulfanyl)-2-phenylethyl]pyridine.
| Compound Name | 2-[1,1-bis(methylsulfanyl)-2-phenylethyl]pyridine |
|---|---|
| PubChem CID | 23584919 |
| Molecular Formula | C15H17NS2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[1,1-bis(methylsulfanyl)-2-phenylethyl]pyridine |
| SMILES | CSC(Cc1ccccc1)(SC)c1ccccn1 |
| InChI | InChI=1S/C15H17NS2/c1-17-15(18-2,14-10-6-7-11-16-14)12-13-8-4-3-5-9-13/h3-11H,12H2,1-2H3 |
| InChIKey | MLUFHPHQCUJWPV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|