C18H22FN — CID 155036452
2-[4-(4-fluorophenyl)-2,3,3-trimethylbutan-2-yl]pyridine (PubChem CID 155036452) has the molecular formula C18H22FN and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-2,3,3-trimethylbutan-2-yl]pyridine.
| Compound Name | 2-[4-(4-fluorophenyl)-2,3,3-trimethylbutan-2-yl]pyridine |
|---|---|
| PubChem CID | 155036452 |
| Molecular Formula | C18H22FN |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-2,3,3-trimethylbutan-2-yl]pyridine |
| SMILES | CC(C)(Cc1ccc(F)cc1)C(C)(C)c1ccccn1 |
| InChI | InChI=1S/C18H22FN/c1-17(2,13-14-8-10-15(19)11-9-14)18(3,4)16-7-5-6-12-20-16/h5-12H,13H2,1-4H3 |
| InChIKey | PSPQPQFURMFOSR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |