C23H19F9N4 — CID 102111943
3,4,5,6-tetrafluoro-2-N,2-N-dimethyl-1-N-[2-methyl-3-(2,3,4,5,6-pentafluoroanilino)-2-pyridin-2-ylpropyl]benzene-1,2-diamine (PubChem CID 102111943) has the molecular formula C23H19F9N4 and a molecular weight of 522.42 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-2-N,2-N-dimethyl-1-N-[2-methyl-3-(2,3,4,5,6-pentafluoroanilino)-2-pyridin-2-ylpropyl]benzene-1,2-diamine.
| Compound Name | 3,4,5,6-tetrafluoro-2-N,2-N-dimethyl-1-N-[2-methyl-3-(2,3,4,5,6-pentafluoroanilino)-2-pyridin-2-ylpropyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 102111943 |
| Molecular Formula | C23H19F9N4 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 3,4,5,6-tetrafluoro-2-N,2-N-dimethyl-1-N-[2-methyl-3-(2,3,4,5,6-pentafluoroanilino)-2-pyridin-2-ylpropyl]benzene-1,2-diamine |
| SMILES | CN(C)c1c(F)c(F)c(F)c(F)c1NCC(C)(CNc1c(F)c(F)c(F)c(F)c1F)c1ccccn1 |
| InChI | InChI=1S/C23H19F9N4/c1-23(10-6-4-5-7-33-10,8-34-20-16(29)12(25)11(24)13(26)17(20)30)9-35-21-18(31)14(27)15(28)19(32)22(21)36(2)3/h4-7,34-35H,8-9H2,1-3H3 |
| InChIKey | FJFZTMFDMOKNAW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|