C12H15F5N2O — CID 106145626
1-(dimethylamino)-2-methyl-3-(2,3,4,5,6-pentafluoroanilino)propan-2-ol (PubChem CID 106145626) has the molecular formula C12H15F5N2O and a molecular weight of 298.26 g/mol. Its IUPAC name is 1-(dimethylamino)-2-methyl-3-(2,3,4,5,6-pentafluoroanilino)propan-2-ol.
| Compound Name | 1-(dimethylamino)-2-methyl-3-(2,3,4,5,6-pentafluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 106145626 |
| Molecular Formula | C12H15F5N2O |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(dimethylamino)-2-methyl-3-(2,3,4,5,6-pentafluoroanilino)propan-2-ol |
| SMILES | CN(C)CC(C)(O)CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H15F5N2O/c1-12(20,5-19(2)3)4-18-11-9(16)7(14)6(13)8(15)10(11)17/h18,20H,4-5H2,1-3H3 |
| InChIKey | RXZUUOQVIHVIBW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|