About methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate
methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate (PubChem CID 106149029) has the molecular formula C14H20F2N2O3
and a molecular weight of 302.32 g/mol. Its IUPAC name is methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate |
| PubChem CID | 106149029 |
| Molecular Formula | C14H20F2N2O3 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate |
| SMILES | COC(=O)c1ccc(NCC(C)(O)CN(C)C)c(F)c1F |
| InChI | InChI=1S/C14H20F2N2O3/c1-14(20,8-18(2)3)7-17-10-6-5-9(13(19)21-4)11(15)12(10)16/h5-6,17,20H,7-8H2,1-4H3 |
| InChIKey | CQXPWALWCHOPPX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate?
The IUPAC name of methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate (CID 106149029) is methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate.
What is the SMILES notation for methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate?
The canonical SMILES for methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate is COC(=O)c1ccc(NCC(C)(O)CN(C)C)c(F)c1F.
What is the InChIKey of methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate?
The InChIKey is CQXPWALWCHOPPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O3/c1-14(20,8-18(2)3)7-17-10-6-5-9(13(19)21-4)11(15)12(10)16/h5-6,17,20H,7-8H2,1-4H3.
What are the key properties of methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate?
methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate has a molecular weight of 302.32 g/mol, XLogP of 1.48, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-2,3-difluorobenzoate is sourced from PubChem (CID 106149029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).