C12H19F2N3O — CID 106141719
1-(2-amino-3,5-difluoroanilino)-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 106141719) has the molecular formula C12H19F2N3O and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-(2-amino-3,5-difluoroanilino)-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-(2-amino-3,5-difluoroanilino)-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106141719 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1-(2-amino-3,5-difluoroanilino)-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | CN(C)CC(C)(O)CNc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C12H19F2N3O/c1-12(18,7-17(2)3)6-16-10-5-8(13)4-9(14)11(10)15/h4-5,16,18H,6-7,15H2,1-3H3 |
| InChIKey | BYRHMGIETTUMJH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|