C12H18F2N2O — CID 106290155
1-(2-amino-3,5-difluoroanilino)-2-methylpentan-2-ol (PubChem CID 106290155) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-(2-amino-3,5-difluoroanilino)-2-methylpentan-2-ol.
| Compound Name | 1-(2-amino-3,5-difluoroanilino)-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 106290155 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-(2-amino-3,5-difluoroanilino)-2-methylpentan-2-ol |
| SMILES | CCCC(C)(O)CNc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C12H18F2N2O/c1-3-4-12(2,17)7-16-10-6-8(13)5-9(14)11(10)15/h5-6,16-17H,3-4,7,15H2,1-2H3 |
| InChIKey | NHUAXQVETVGTAA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|