C42H48N4O2 — CID 67914803
N-benzyl-1-phenylmethanamine;1,1-dibenzyl-3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]urea (PubChem CID 67914803) has the molecular formula C42H48N4O2 and a molecular weight of 640.87 g/mol. Its IUPAC name is N-benzyl-1-phenylmethanamine;1,1-dibenzyl-3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]urea.
| Compound Name | N-benzyl-1-phenylmethanamine;1,1-dibenzyl-3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]urea |
|---|---|
| PubChem CID | 67914803 |
| Molecular Formula | C42H48N4O2 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | N-benzyl-1-phenylmethanamine;1,1-dibenzyl-3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC(=O)N(Cc1ccccc1)Cc1ccccc1.c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H33N3O2.C14H15N/c1-20(2)24-16-11-17-25(21(3)4)26(24)29-27(32)30-28(33)31(18-22-12-7-5-8-13-22)19-23-14-9-6-10-15-23;1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h5-17,20-21H,18-19H2,1-4H3,(H2,29,30,32,33);1-10,15H,11-12H2 |
| InChIKey | OMAMTXTYMVZWNR-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |