C32H40N2O — CID 3072996
1-benzyl-3-[2,6-di(propan-2-yl)phenyl]-1-(4-phenylcyclohexyl)urea (PubChem CID 3072996) has the molecular formula C32H40N2O and a molecular weight of 468.69 g/mol. Its IUPAC name is 1-benzyl-3-[2,6-di(propan-2-yl)phenyl]-1-(4-phenylcyclohexyl)urea.
| Compound Name | 1-benzyl-3-[2,6-di(propan-2-yl)phenyl]-1-(4-phenylcyclohexyl)urea |
|---|---|
| PubChem CID | 3072996 |
| Molecular Formula | C32H40N2O |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 1-benzyl-3-[2,6-di(propan-2-yl)phenyl]-1-(4-phenylcyclohexyl)urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)N(Cc1ccccc1)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C32H40N2O/c1-23(2)29-16-11-17-30(24(3)4)31(29)33-32(35)34(22-25-12-7-5-8-13-25)28-20-18-27(19-21-28)26-14-9-6-10-15-26/h5-17,23-24,27-28H,18-22H2,1-4H3,(H,33,35) |
| InChIKey | MMABCDHYXCTBBS-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |