C38H52N2O2 — CID 19935039
3-[2,6-di(propan-2-yl)phenyl]-1-[(4-hexoxyphenyl)methyl]-1-(4-phenylcyclohexyl)urea (PubChem CID 19935039) has the molecular formula C38H52N2O2 and a molecular weight of 568.85 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1-[(4-hexoxyphenyl)methyl]-1-(4-phenylcyclohexyl)urea.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1-[(4-hexoxyphenyl)methyl]-1-(4-phenylcyclohexyl)urea |
|---|---|
| PubChem CID | 19935039 |
| Molecular Formula | C38H52N2O2 |
| Molecular Weight | 568.85 g/mol |
| Exact Mass | 568.40 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1-[(4-hexoxyphenyl)methyl]-1-(4-phenylcyclohexyl)urea |
| SMILES | CCCCCCOc1ccc(CN(C(=O)Nc2c(C(C)C)cccc2C(C)C)C2CCC(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C38H52N2O2/c1-6-7-8-12-26-42-34-24-18-30(19-25-34)27-40(33-22-20-32(21-23-33)31-14-10-9-11-15-31)38(41)39-37-35(28(2)3)16-13-17-36(37)29(4)5/h9-11,13-19,24-25,28-29,32-33H,6-8,12,20-23,26-27H2,1-5H3,(H,39,41) |
| InChIKey | NCSJHIYOCHHVBE-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.85 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|