C22H27N3O2 — CID 46995679
N-(2-propan-2-ylphenyl)-N'-prop-2-enyl-N'-(pyridin-2-ylmethyl)butanediamide (PubChem CID 46995679) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(2-propan-2-ylphenyl)-N'-prop-2-enyl-N'-(pyridin-2-ylmethyl)butanediamide.
| Compound Name | N-(2-propan-2-ylphenyl)-N'-prop-2-enyl-N'-(pyridin-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 46995679 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-(2-propan-2-ylphenyl)-N'-prop-2-enyl-N'-(pyridin-2-ylmethyl)butanediamide |
| SMILES | C=CCN(Cc1ccccn1)C(=O)CCC(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C22H27N3O2/c1-4-15-25(16-18-9-7-8-14-23-18)22(27)13-12-21(26)24-20-11-6-5-10-19(20)17(2)3/h4-11,14,17H,1,12-13,15-16H2,2-3H3,(H,24,26) |
| InChIKey | MHOKZSAPNFDGIJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|